C18H18N2O5S — CID 66743389
benzyl N-[methylsulfanyloxy(phenylmethoxycarbonylamino)methylidene]carbamate (PubChem CID 66743389) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is benzyl N-[methylsulfanyloxy(phenylmethoxycarbonylamino)methylidene]carbamate.
| Compound Name | benzyl N-[methylsulfanyloxy(phenylmethoxycarbonylamino)methylidene]carbamate |
|---|---|
| PubChem CID | 66743389 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | benzyl N-[methylsulfanyloxy(phenylmethoxycarbonylamino)methylidene]carbamate |
| SMILES | CSOC(=NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-26-25-16(19-17(21)23-12-14-8-4-2-5-9-14)20-18(22)24-13-15-10-6-3-7-11-15/h2-11H,12-13H2,1H3,(H,19,20,21,22) |
| InChIKey | BCDDBGCLJLAFGA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|