C23H21N3O5 — CID 68634310
benzyl N-[amino-[[4-(2-hydroxyphenyl)phenyl]methoxycarbonylamino]methylidene]carbamate (PubChem CID 68634310) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is benzyl N-[amino-[[4-(2-hydroxyphenyl)phenyl]methoxycarbonylamino]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[[4-(2-hydroxyphenyl)phenyl]methoxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 68634310 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | benzyl N-[amino-[[4-(2-hydroxyphenyl)phenyl]methoxycarbonylamino]methylidene]carbamate |
| SMILES | NC(=NC(=O)OCc1ccccc1)NC(=O)OCc1ccc(-c2ccccc2O)cc1 |
| InChI | InChI=1S/C23H21N3O5/c24-21(25-22(28)30-14-16-6-2-1-3-7-16)26-23(29)31-15-17-10-12-18(13-11-17)19-8-4-5-9-20(19)27/h1-13,27H,14-15H2,(H3,24,25,26,28,29) |
| InChIKey | JIPREGOLHMORLM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|