C15H14N4O4 — CID 177424221
benzyl (NE)-N-[amino-[(5-formyl-1H-pyrrole-2-carbonyl)amino]methylidene]carbamate (PubChem CID 177424221) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is benzyl (NE)-N-[amino-[(5-formyl-1H-pyrrole-2-carbonyl)amino]methylidene]carbamate.
| Compound Name | benzyl (NE)-N-[amino-[(5-formyl-1H-pyrrole-2-carbonyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 177424221 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | benzyl (NE)-N-[amino-[(5-formyl-1H-pyrrole-2-carbonyl)amino]methylidene]carbamate |
| SMILES | N/C(=N\C(=O)OCc1ccccc1)NC(=O)c1ccc(C=O)[nH]1 |
| InChI | InChI=1S/C15H14N4O4/c16-14(18-13(21)12-7-6-11(8-20)17-12)19-15(22)23-9-10-4-2-1-3-5-10/h1-8,17H,9H2,(H3,16,18,19,21,22) |
| InChIKey | HCNAUUVMKPJMML-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|