C30H28N6O6 — CID 54754158
benzyl (NE)-N-[amino-[[5-[[2-(phenylmethoxycarbonylaminomethyl)phenyl]carbamoyl]-1H-pyrrole-2-carbonyl]amino]methylidene]carbamate (PubChem CID 54754158) has the molecular formula C30H28N6O6 and a molecular weight of 568.59 g/mol. Its IUPAC name is benzyl (NE)-N-[amino-[[5-[[2-(phenylmethoxycarbonylaminomethyl)phenyl]carbamoyl]-1H-pyrrole-2-carbonyl]amino]methylidene]carbamate.
| Compound Name | benzyl (NE)-N-[amino-[[5-[[2-(phenylmethoxycarbonylaminomethyl)phenyl]carbamoyl]-1H-pyrrole-2-carbonyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 54754158 |
| Molecular Formula | C30H28N6O6 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | benzyl (NE)-N-[amino-[[5-[[2-(phenylmethoxycarbonylaminomethyl)phenyl]carbamoyl]-1H-pyrrole-2-carbonyl]amino]methylidene]carbamate |
| SMILES | N/C(=N\C(=O)OCc1ccccc1)NC(=O)c1ccc(C(=O)Nc2ccccc2CNC(=O)OCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C30H28N6O6/c31-28(36-30(40)42-19-21-11-5-2-6-12-21)35-27(38)25-16-15-24(33-25)26(37)34-23-14-8-7-13-22(23)17-32-29(39)41-18-20-9-3-1-4-10-20/h1-16,33H,17-19H2,(H,32,39)(H,34,37)(H3,31,35,36,38,40) |
| InChIKey | NNWJPYVRNFXWTI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|