C31H30F3N5O5 — CID 67152836
benzyl N-[amino-[[4-[1-[4-(methylcarbamoyl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate (PubChem CID 67152836) has the molecular formula C31H30F3N5O5 and a molecular weight of 609.61 g/mol. Its IUPAC name is benzyl N-[amino-[[4-[1-[4-(methylcarbamoyl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[[4-[1-[4-(methylcarbamoyl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 67152836 |
| Molecular Formula | C31H30F3N5O5 |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | benzyl N-[amino-[[4-[1-[4-(methylcarbamoyl)benzoyl]piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
| SMILES | CNC(=O)c1ccc(C(=O)N2CCC(c3ccc(C(=O)NC(N)=NC(=O)OCc4ccccc4)cc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C31H30F3N5O5/c1-36-26(40)21-7-9-22(10-8-21)28(42)39-15-13-20(14-16-39)24-12-11-23(17-25(24)31(32,33)34)27(41)37-29(35)38-30(43)44-18-19-5-3-2-4-6-19/h2-12,17,20H,13-16,18H2,1H3,(H,36,40)(H3,35,37,38,41,43) |
| InChIKey | UEDHHBGLWOYFFZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|