C25H33F3N4O4 — CID 66560491
tert-butyl (NZ)-N-[amino-[[4-[1-(cyclopentanecarbonyl)piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate (PubChem CID 66560491) has the molecular formula C25H33F3N4O4 and a molecular weight of 510.56 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[amino-[[4-[1-(cyclopentanecarbonyl)piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[amino-[[4-[1-(cyclopentanecarbonyl)piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 66560491 |
| Molecular Formula | C25H33F3N4O4 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | tert-butyl (NZ)-N-[amino-[[4-[1-(cyclopentanecarbonyl)piperidin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(/N)NC(=O)c1ccc(C2CCN(C(=O)C3CCCC3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H33F3N4O4/c1-24(2,3)36-23(35)31-22(29)30-20(33)17-8-9-18(19(14-17)25(26,27)28)15-10-12-32(13-11-15)21(34)16-6-4-5-7-16/h8-9,14-16H,4-7,10-13H2,1-3H3,(H3,29,30,31,33,35) |
| InChIKey | ZONISQBSGWOCEA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|