C17H22F3N5O2 — CID 58269547
4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenyl]-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 58269547) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenyl]-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenyl]-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 58269547 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[4-(diaminomethylidenecarbamoyl)-2-(trifluoromethyl)phenyl]-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(c2ccc(C(=O)N=C(N)N)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H22F3N5O2/c1-24(2)16(27)25-7-5-10(6-8-25)12-4-3-11(14(26)23-15(21)22)9-13(12)17(18,19)20/h3-4,9-10H,5-8H2,1-2H3,(H4,21,22,23,26) |
| InChIKey | XHLSNIVPKFFIBU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|