C19H21F3N6O2 — CID 58269632
N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2-methyl-5-(trifluoromethyl)benzamide (PubChem CID 58269632) has the molecular formula C19H21F3N6O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2-methyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2-methyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58269632 |
| Molecular Formula | C19H21F3N6O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2-methyl-5-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C2CCN(C(=O)c3ncc[nH]3)CC2)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C19H21F3N6O2/c1-10-8-13(14(19(20,21)22)9-12(10)16(29)27-18(23)24)11-2-6-28(7-3-11)17(30)15-25-4-5-26-15/h4-5,8-9,11H,2-3,6-7H2,1H3,(H,25,26)(H4,23,24,27,29) |
| InChIKey | MDYYKXMIVYVUAQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|