C19H24N6O2 — CID 58269549
N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2,5-dimethylbenzamide (PubChem CID 58269549) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2,5-dimethylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 58269549 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-(diaminomethylidene)-4-[1-(1H-imidazole-2-carbonyl)piperidin-4-yl]-2,5-dimethylbenzamide |
| SMILES | Cc1cc(C2CCN(C(=O)c3ncc[nH]3)CC2)c(C)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C19H24N6O2/c1-11-10-15(17(26)24-19(20)21)12(2)9-14(11)13-3-7-25(8-4-13)18(27)16-22-5-6-23-16/h5-6,9-10,13H,3-4,7-8H2,1-2H3,(H,22,23)(H4,20,21,24,26) |
| InChIKey | NRHBJSFFZBABET-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|