C26H24F3N5O2 — CID 58269706
N-(diaminomethylidene)-4-[1-(3-pyridin-2-ylbenzoyl)piperidin-4-yl]-3-(trifluoromethyl)benzamide (PubChem CID 58269706) has the molecular formula C26H24F3N5O2 and a molecular weight of 495.51 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[1-(3-pyridin-2-ylbenzoyl)piperidin-4-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(diaminomethylidene)-4-[1-(3-pyridin-2-ylbenzoyl)piperidin-4-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58269706 |
| Molecular Formula | C26H24F3N5O2 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-(diaminomethylidene)-4-[1-(3-pyridin-2-ylbenzoyl)piperidin-4-yl]-3-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NC(=O)c1ccc(C2CCN(C(=O)c3cccc(-c4ccccn4)c3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H24F3N5O2/c27-26(28,29)21-15-18(23(35)33-25(30)31)7-8-20(21)16-9-12-34(13-10-16)24(36)19-5-3-4-17(14-19)22-6-1-2-11-32-22/h1-8,11,14-16H,9-10,12-13H2,(H4,30,31,33,35) |
| InChIKey | IHTMDXRIXBUPJW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|