C21H26F3N7O2 — CID 58269732
4-[1-[(2R)-2-amino-3-(1-methylimidazol-4-yl)propanoyl]piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide (PubChem CID 58269732) has the molecular formula C21H26F3N7O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 4-[1-[(2R)-2-amino-3-(1-methylimidazol-4-yl)propanoyl]piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[1-[(2R)-2-amino-3-(1-methylimidazol-4-yl)propanoyl]piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58269732 |
| Molecular Formula | C21H26F3N7O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 4-[1-[(2R)-2-amino-3-(1-methylimidazol-4-yl)propanoyl]piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
| SMILES | Cn1cnc(C[C@@H](N)C(=O)N2CCC(c3ccc(C(=O)N=C(N)N)cc3C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C21H26F3N7O2/c1-30-10-14(28-11-30)9-17(25)19(33)31-6-4-12(5-7-31)15-3-2-13(18(32)29-20(26)27)8-16(15)21(22,23)24/h2-3,8,10-12,17H,4-7,9,25H2,1H3,(H4,26,27,29,32)/t17-/m1/s1 |
| InChIKey | XKDRUERRMGQMFB-QGZVFWFLSA-N |
| XLogP | 1.13 |
| TPSA | 145.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|