C19H24F3N5O2 — CID 58269697
4-[1-(1-aminocyclobutanecarbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide (PubChem CID 58269697) has the molecular formula C19H24F3N5O2 and a molecular weight of 411.43 g/mol. Its IUPAC name is 4-[1-(1-aminocyclobutanecarbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[1-(1-aminocyclobutanecarbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58269697 |
| Molecular Formula | C19H24F3N5O2 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-[1-(1-aminocyclobutanecarbonyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NC(=O)c1ccc(C2CCN(C(=O)C3(N)CCC3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3N5O2/c20-19(21,22)14-10-12(15(28)26-17(23)24)2-3-13(14)11-4-8-27(9-5-11)16(29)18(25)6-1-7-18/h2-3,10-11H,1,4-9,25H2,(H4,23,24,26,28) |
| InChIKey | GOFTVRJKGDIHHB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|