C24H21F6N5O4 — CID 66560565
4-[1-(4-cyanobenzoyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 66560565) has the molecular formula C24H21F6N5O4 and a molecular weight of 557.45 g/mol. Its IUPAC name is 4-[1-(4-cyanobenzoyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[1-(4-cyanobenzoyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66560565 |
| Molecular Formula | C24H21F6N5O4 |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | 4-[1-(4-cyanobenzoyl)piperidin-4-yl]-N-(diaminomethylidene)-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | N#Cc1ccc(C(=O)N2CCC(c3ccc(C(=O)N=C(N)N)cc3C(F)(F)F)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H20F3N5O2.C2HF3O2/c23-22(24,25)18-11-16(19(31)29-21(27)28)5-6-17(18)14-7-9-30(10-8-14)20(32)15-3-1-13(12-26)2-4-15;3-2(4,5)1(6)7/h1-6,11,14H,7-10H2,(H4,27,28,29,31);(H,6,7) |
| InChIKey | OVSPIVYQUQWQBD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 162.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|