C27H28F3N5O5S — CID 91412240
N-(diaminomethylidene)-4-[1-[hydroxy-[2-(2-methylsulfonylphenoxy)-4-pyridinyl]methyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide (PubChem CID 91412240) has the molecular formula C27H28F3N5O5S and a molecular weight of 591.61 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[1-[hydroxy-[2-(2-methylsulfonylphenoxy)-4-pyridinyl]methyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(diaminomethylidene)-4-[1-[hydroxy-[2-(2-methylsulfonylphenoxy)-4-pyridinyl]methyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91412240 |
| Molecular Formula | C27H28F3N5O5S |
| Molecular Weight | 591.61 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | N-(diaminomethylidene)-4-[1-[hydroxy-[2-(2-methylsulfonylphenoxy)-4-pyridinyl]methyl]piperidin-4-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CS(=O)(=O)c1ccccc1Oc1cc(C(O)N2CCC(c3ccc(C(=O)N=C(N)N)cc3C(F)(F)F)CC2)ccn1 |
| InChI | InChI=1S/C27H28F3N5O5S/c1-41(38,39)22-5-3-2-4-21(22)40-23-15-18(8-11-33-23)25(37)35-12-9-16(10-13-35)19-7-6-17(24(36)34-26(31)32)14-20(19)27(28,29)30/h2-8,11,14-16,25,37H,9-10,12-13H2,1H3,(H4,31,32,34,36) |
| InChIKey | YFFJXWXKGJUNNH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 161.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|