C21H25N5O3 — CID 58269553
N-(diaminomethylidene)-2,5-dimethyl-4-[1-(6-oxo-1H-pyridine-3-carbonyl)piperidin-4-yl]benzamide (PubChem CID 58269553) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,5-dimethyl-4-[1-(6-oxo-1H-pyridine-3-carbonyl)piperidin-4-yl]benzamide.
| Compound Name | N-(diaminomethylidene)-2,5-dimethyl-4-[1-(6-oxo-1H-pyridine-3-carbonyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 58269553 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-(diaminomethylidene)-2,5-dimethyl-4-[1-(6-oxo-1H-pyridine-3-carbonyl)piperidin-4-yl]benzamide |
| SMILES | Cc1cc(C2CCN(C(=O)c3ccc(=O)[nH]c3)CC2)c(C)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C21H25N5O3/c1-12-10-17(19(28)25-21(22)23)13(2)9-16(12)14-5-7-26(8-6-14)20(29)15-3-4-18(27)24-11-15/h3-4,9-11,14H,5-8H2,1-2H3,(H,24,27)(H4,22,23,25,28) |
| InChIKey | VALGXOICSLBRSV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|