C22H25FN4O4S — CID 44609646
N-(diaminomethylidene)-4-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-methyl-5-methylsulfonylbenzamide (PubChem CID 44609646) has the molecular formula C22H25FN4O4S and a molecular weight of 460.53 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-methyl-5-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 44609646 |
| Molecular Formula | C22H25FN4O4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-(diaminomethylidene)-4-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-methyl-5-methylsulfonylbenzamide |
| SMILES | Cc1cc(C2CCN(C(=O)c3ccc(F)cc3)CC2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C22H25FN4O4S/c1-13-11-18(19(32(2,30)31)12-17(13)20(28)26-22(24)25)14-7-9-27(10-8-14)21(29)15-3-5-16(23)6-4-15/h3-6,11-12,14H,7-10H2,1-2H3,(H4,24,25,26,28) |
| InChIKey | CZMAQGQOXLCUMP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|