C18H23N7O3S — CID 10740684
N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzamide (PubChem CID 10740684) has the molecular formula C18H23N7O3S and a molecular weight of 417.50 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzamide.
| Compound Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 10740684 |
| Molecular Formula | C18H23N7O3S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzamide |
| SMILES | Cc1cc(N2CCN(c3ncccn3)CC2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C18H23N7O3S/c1-12-10-14(15(29(2,27)28)11-13(12)16(26)23-17(19)20)24-6-8-25(9-7-24)18-21-4-3-5-22-18/h3-5,10-11H,6-9H2,1-2H3,(H4,19,20,23,26) |
| InChIKey | HOMSPJWDEDIONK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|