C19H29N5O2 — CID 58269745
4-[1-(2-amino-2-methylpropanoyl)piperidin-4-yl]-N-(diaminomethylidene)-2,5-dimethylbenzamide (PubChem CID 58269745) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[1-(2-amino-2-methylpropanoyl)piperidin-4-yl]-N-(diaminomethylidene)-2,5-dimethylbenzamide.
| Compound Name | 4-[1-(2-amino-2-methylpropanoyl)piperidin-4-yl]-N-(diaminomethylidene)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 58269745 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 4-[1-(2-amino-2-methylpropanoyl)piperidin-4-yl]-N-(diaminomethylidene)-2,5-dimethylbenzamide |
| SMILES | Cc1cc(C2CCN(C(=O)C(C)(C)N)CC2)c(C)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C19H29N5O2/c1-11-10-15(16(25)23-18(20)21)12(2)9-14(11)13-5-7-24(8-6-13)17(26)19(3,4)22/h9-10,13H,5-8,22H2,1-4H3,(H4,20,21,23,25) |
| InChIKey | ZIURYXFHAPUMDD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|