C30H27F3N4O6S — CID 67152809
benzyl N-[amino-[[4-[1-(4-methylsulfonylbenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate (PubChem CID 67152809) has the molecular formula C30H27F3N4O6S and a molecular weight of 628.63 g/mol. Its IUPAC name is benzyl N-[amino-[[4-[1-(4-methylsulfonylbenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[[4-[1-(4-methylsulfonylbenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 67152809 |
| Molecular Formula | C30H27F3N4O6S |
| Molecular Weight | 628.63 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | benzyl N-[amino-[[4-[1-(4-methylsulfonylbenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CC=C(c3ccc(C(=O)NC(N)=NC(=O)OCc4ccccc4)cc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C30H27F3N4O6S/c1-44(41,42)23-10-7-21(8-11-23)27(39)37-15-13-20(14-16-37)24-12-9-22(17-25(24)30(31,32)33)26(38)35-28(34)36-29(40)43-18-19-5-3-2-4-6-19/h2-13,17H,14-16,18H2,1H3,(H3,34,35,36,38,40) |
| InChIKey | GDMIVVPVBJSLFP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|