C26H25N3O6 — CID 58617308
benzyl N-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-N-methylcarbamate (PubChem CID 58617308) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is benzyl N-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-N-methylcarbamate.
| Compound Name | benzyl N-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58617308 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | benzyl N-[(Z)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)/C(=N\C(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H25N3O6/c1-29(26(32)35-19-22-15-9-4-10-16-22)23(27-24(30)33-17-20-11-5-2-6-12-20)28-25(31)34-18-21-13-7-3-8-14-21/h2-16H,17-19H2,1H3,(H,27,28,30,31) |
| InChIKey | MPGZBVJMGJDSMN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|