C11H13N3O3S — CID 85374062
benzyl N-[[amino(methylsulfanyl)methylidene]carbamoyl]carbamate (PubChem CID 85374062) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is benzyl N-[[amino(methylsulfanyl)methylidene]carbamoyl]carbamate.
| Compound Name | benzyl N-[[amino(methylsulfanyl)methylidene]carbamoyl]carbamate |
|---|---|
| PubChem CID | 85374062 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | benzyl N-[[amino(methylsulfanyl)methylidene]carbamoyl]carbamate |
| SMILES | CSC(N)=NC(=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H13N3O3S/c1-18-9(12)13-10(15)14-11(16)17-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | KKLHLJKIBXPOGH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|