C15H20N2O4S — CID 53242853
benzyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]carbamate (PubChem CID 53242853) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is benzyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]carbamate.
| Compound Name | benzyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]carbamate |
|---|---|
| PubChem CID | 53242853 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | benzyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]carbamate |
| SMILES | CS/C(=N/C(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20N2O4S/c1-15(2,3)21-14(19)17-12(22-4)16-13(18)20-10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3,(H,16,17,18,19) |
| InChIKey | GPSDTOAKHIYRFM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|