C17H22N2O3S — CID 155163339
benzyl N-[(hept-6-enoylamino)-methylsulfanylmethylidene]carbamate (PubChem CID 155163339) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is benzyl N-[(hept-6-enoylamino)-methylsulfanylmethylidene]carbamate.
| Compound Name | benzyl N-[(hept-6-enoylamino)-methylsulfanylmethylidene]carbamate |
|---|---|
| PubChem CID | 155163339 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | benzyl N-[(hept-6-enoylamino)-methylsulfanylmethylidene]carbamate |
| SMILES | C=CCCCCC(=O)NC(=NC(=O)OCc1ccccc1)SC |
| InChI | InChI=1S/C17H22N2O3S/c1-3-4-5-9-12-15(20)18-16(23-2)19-17(21)22-13-14-10-7-6-8-11-14/h3,6-8,10-11H,1,4-5,9,12-13H2,2H3,(H,18,19,20,21) |
| InChIKey | LVFRXEPRPBVEJA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|