C29H41N3O5 — CID 174113043
(1-but-3-enylcyclopentyl) 2-[methyl-(N-oct-7-enoyl-N'-phenylmethoxycarbonylcarbamimidoyl)amino]acetate (PubChem CID 174113043) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is (1-but-3-enylcyclopentyl) 2-[methyl-(N-oct-7-enoyl-N'-phenylmethoxycarbonylcarbamimidoyl)amino]acetate.
| Compound Name | (1-but-3-enylcyclopentyl) 2-[methyl-(N-oct-7-enoyl-N'-phenylmethoxycarbonylcarbamimidoyl)amino]acetate |
|---|---|
| PubChem CID | 174113043 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | (1-but-3-enylcyclopentyl) 2-[methyl-(N-oct-7-enoyl-N'-phenylmethoxycarbonylcarbamimidoyl)amino]acetate |
| SMILES | C=CCCCCCC(=O)NC(=NC(=O)OCc1ccccc1)N(C)CC(=O)OC1(CCC=C)CCCC1 |
| InChI | InChI=1S/C29H41N3O5/c1-4-6-8-9-13-18-25(33)30-27(31-28(35)36-23-24-16-11-10-12-17-24)32(3)22-26(34)37-29(19-7-5-2)20-14-15-21-29/h4-5,10-12,16-17H,1-2,6-9,13-15,18-23H2,3H3,(H,30,31,33,35) |
| InChIKey | NALYFPXVYDIRMB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|