C22H29NO4 — CID 11588792
benzyl 2-but-3-enyl-2-(4-methoxy-2-methylidene-4-oxobutyl)pyrrolidine-1-carboxylate (PubChem CID 11588792) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is benzyl 2-but-3-enyl-2-(4-methoxy-2-methylidene-4-oxobutyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-but-3-enyl-2-(4-methoxy-2-methylidene-4-oxobutyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11588792 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | benzyl 2-but-3-enyl-2-(4-methoxy-2-methylidene-4-oxobutyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCCC1(CC(=C)CC(=O)OC)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29NO4/c1-4-5-12-22(16-18(2)15-20(24)26-3)13-9-14-23(22)21(25)27-17-19-10-7-6-8-11-19/h4,6-8,10-11H,1-2,5,9,12-17H2,3H3 |
| InChIKey | PVHZAHPASVFCLF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|