C20H21NO5 — CID 22215050
dibenzyl 2-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 22215050) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is dibenzyl 2-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl 2-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22215050 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | dibenzyl 2-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC1(O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO5/c22-18(25-14-16-8-3-1-4-9-16)20(24)12-7-13-21(20)19(23)26-15-17-10-5-2-6-11-17/h1-6,8-11,24H,7,12-15H2 |
| InChIKey | LFKPROLQDBQGIO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |