benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate

C17H24N2O2 — CID 126752953

IUPACbenzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate
SMILESCC(C)N1CC2(CCCN2C(=O)OCc2ccccc2)C1
InChIInChI=1S/C17H24N2O2/c1-14(2)18-12-17(13-18)9-6-10-19(17)16(20)21-11-15-7-4-3-5-8-15/h3-5,7-8,14H,6,9-13H2,1-2H3
InChIKeyKQLXNYPUHZJRNE-UHFFFAOYSA-N
MW288.39 g/mol
LogP2.88
Rot. Bonds3

About benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate

benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate (PubChem CID 126752953) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate.

Molecular Properties

Compound Namebenzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate
PubChem CID126752953
Molecular FormulaC17H24N2O2
Molecular Weight288.39 g/mol
Exact Mass288.18
IUPAC Namebenzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate
SMILESCC(C)N1CC2(CCCN2C(=O)OCc2ccccc2)C1
InChIInChI=1S/C17H24N2O2/c1-14(2)18-12-17(13-18)9-6-10-19(17)16(20)21-11-15-7-4-3-5-8-15/h3-5,7-8,14H,6,9-13H2,1-2H3
InChIKeyKQLXNYPUHZJRNE-UHFFFAOYSA-N
XLogP2.88
TPSA32.78 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.39
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate?
The IUPAC name of benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate (CID 126752953) is benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate.
What is the SMILES notation for benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate?
The canonical SMILES for benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate is CC(C)N1CC2(CCCN2C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate?
The InChIKey is KQLXNYPUHZJRNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-14(2)18-12-17(13-18)9-6-10-19(17)16(20)21-11-15-7-4-3-5-8-15/h3-5,7-8,14H,6,9-13H2,1-2H3.
What are the key properties of benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate?
benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate has a molecular weight of 288.39 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-propan-2-yl-2,5-diazaspiro[3.4]octane-5-carboxylate is sourced from PubChem (CID 126752953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).