About 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate
1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 86326307) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate.
Analyze 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate?
The IUPAC name of 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate (CID 86326307) is 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate is COC(=O)[C@]1(C)CCCN1C(=O)OCc1ccccc1.
What is the InChIKey of 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate?
The InChIKey is UUZYJNOJPVEUBY-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H19NO4/c1-15(13(17)19-2)9-6-10-16(15)14(18)20-11-12-7-4-3-5-8-12/h3-5,7-8H,6,9-11H2,1-2H3/t15-/m0/s1.
What are the key properties of 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate?
1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate has a molecular weight of 277.32 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 86326307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).