C16H21NO4 — CID 25194780
1-O-benzyl 2-O-methyl 2-methylpiperidine-1,2-dicarboxylate (PubChem CID 25194780) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl 2-methylpiperidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl 2-methylpiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 25194780 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-O-benzyl 2-O-methyl 2-methylpiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1(C)CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-16(14(18)20-2)10-6-7-11-17(16)15(19)21-12-13-8-4-3-5-9-13/h3-5,8-9H,6-7,10-12H2,1-2H3 |
| InChIKey | IJYXGXFUJGLDGV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |