C21H20ClNO5 — CID 151279854
dibenzyl (2S)-2-carbonochloridoylpyrrolidine-1,2-dicarboxylate (PubChem CID 151279854) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is dibenzyl (2S)-2-carbonochloridoylpyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2S)-2-carbonochloridoylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 151279854 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | dibenzyl (2S)-2-carbonochloridoylpyrrolidine-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@@]1(C(=O)Cl)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H20ClNO5/c22-18(24)21(19(25)27-14-16-8-3-1-4-9-16)12-7-13-23(21)20(26)28-15-17-10-5-2-6-11-17/h1-6,8-11H,7,12-15H2/t21-/m1/s1 |
| InChIKey | NYDKIMRNDNGRPH-OAQYLSRUSA-N |
| XLogP | 3.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|