C20H20N2O6 — CID 20757882
(2R)-2-[(3-hydroxyphenyl)carbamoyl]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 20757882) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2R)-2-[(3-hydroxyphenyl)carbamoyl]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-[(3-hydroxyphenyl)carbamoyl]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 20757882 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (2R)-2-[(3-hydroxyphenyl)carbamoyl]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@]1(C(=O)O)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C20H20N2O6/c23-16-9-4-8-15(12-16)21-17(24)20(18(25)26)10-5-11-22(20)19(27)28-13-14-6-2-1-3-7-14/h1-4,6-9,12,23H,5,10-11,13H2,(H,21,24)(H,25,26)/t20-/m1/s1 |
| InChIKey | RSGFOHRTLMFVDP-HXUWFJFHSA-N |
| XLogP | 2.59 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|