C15H17ClN4O3 — CID 11450544
tert-butyl N-[(E)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate (PubChem CID 11450544) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is tert-butyl N-[(E)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate.
| Compound Name | tert-butyl N-[(E)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate |
|---|---|
| PubChem CID | 11450544 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | tert-butyl N-[(E)-[amino-[(2R,3R)-3-(4-chlorophenyl)-2-cyanooxiran-2-yl]methylidene]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C(/N)[C@@]1(C#N)O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN4O3/c1-14(2,3)23-13(21)20-19-12(18)15(8-17)11(22-15)9-4-6-10(16)7-5-9/h4-7,11H,1-3H3,(H2,18,19)(H,20,21)/t11-,15+/m1/s1 |
| InChIKey | GAHCLATUPWLENH-ABAIWWIYSA-N |
| XLogP | 2.47 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|