C23H18N4O3 — CID 23306827
(1R,4S,5S,7R)-3-imino-5-(4-methoxyphenyl)-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile (PubChem CID 23306827) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is (1R,4S,5S,7R)-3-imino-5-(4-methoxyphenyl)-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile.
| Compound Name | (1R,4S,5S,7R)-3-imino-5-(4-methoxyphenyl)-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 23306827 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (1R,4S,5S,7R)-3-imino-5-(4-methoxyphenyl)-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@@]2(C)O[C@@H](c3ccc(OC)cc3)[C@@]1(C#N)C(C#N)(C#N)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H18N4O3/c1-21-18(15-6-4-3-5-7-15)22(12-24,13-25)23(14-26,20(27)30-21)19(29-21)16-8-10-17(28-2)11-9-16/h3-11,18-19,27H,1-2H3/b27-20-/t18-,19-,21+,23+/m0/s1 |
| InChIKey | MSQNXJQXDDDHNZ-HEUFHIPHSA-N |
| XLogP | 3.82 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|