C20H14N4O3 — CID 98055743
(1S,3R,4R,7R)-3-(furan-2-yl)-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile (PubChem CID 98055743) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is (1S,3R,4R,7R)-3-(furan-2-yl)-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile.
| Compound Name | (1S,3R,4R,7R)-3-(furan-2-yl)-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 98055743 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (1S,3R,4R,7R)-3-(furan-2-yl)-5-imino-1-methyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@]2(C)O[C@@H](c3ccco3)[C@]1(C#N)C(C#N)(C#N)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C20H14N4O3/c1-18-15(13-6-3-2-4-7-13)19(10-21,11-22)20(12-23,17(24)27-18)16(26-18)14-8-5-9-25-14/h2-9,15-16,24H,1H3/b24-17-/t15-,16-,18-,20-/m0/s1 |
| InChIKey | RHQCNXVWUHSVNE-HZTHDZNXSA-N |
| XLogP | 3.40 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|