C15H12N4O3 — CID 98388147
(1R,3S,4S,7R)-3-(furan-2-yl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile (PubChem CID 98388147) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is (1R,3S,4S,7R)-3-(furan-2-yl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile.
| Compound Name | (1R,3S,4S,7R)-3-(furan-2-yl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 98388147 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (1R,3S,4S,7R)-3-(furan-2-yl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@@]2(C)O[C@H](c3ccco3)[C@@]1(C#N)C(C#N)(C#N)[C@H]2C |
| InChI | InChI=1S/C15H12N4O3/c1-9-13(2)21-11(10-4-3-5-20-10)15(8-18,12(19)22-13)14(9,6-16)7-17/h3-5,9,11,19H,1-2H3/b19-12-/t9-,11+,13+,15+/m0/s1 |
| InChIKey | SQKRNLOXJMBZRP-KBRCXZAYSA-N |
| XLogP | 2.25 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|