C17H13ClN4O2 — CID 124774699
(1R,3R,4S,7R)-3-(2-chlorophenyl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile (PubChem CID 124774699) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is (1R,3R,4S,7R)-3-(2-chlorophenyl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile.
| Compound Name | (1R,3R,4S,7R)-3-(2-chlorophenyl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 124774699 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (1R,3R,4S,7R)-3-(2-chlorophenyl)-5-imino-1,7-dimethyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@@]2(C)O[C@@H](c3ccccc3Cl)[C@@]1(C#N)C(C#N)(C#N)[C@H]2C |
| InChI | InChI=1S/C17H13ClN4O2/c1-10-15(2)23-13(11-5-3-4-6-12(11)18)17(9-21,14(22)24-15)16(10,7-19)8-20/h3-6,10,13,22H,1-2H3/b22-14-/t10-,13-,15+,17+/m0/s1 |
| InChIKey | KSIJAWXPQCVRDP-MSQNXCGCSA-N |
| XLogP | 3.31 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|