C19H18N4O4 — CID 100818333
(1S,3S,5S,8S)-3-(2,3-dimethoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 100818333) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is (1S,3S,5S,8S)-3-(2,3-dimethoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | (1S,3S,5S,8S)-3-(2,3-dimethoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 100818333 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (1S,3S,5S,8S)-3-(2,3-dimethoxyphenyl)-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@]2(C)O[C@H](c3cccc(OC)c3OC)C(C#N)(C#N)[C@]1(C#N)[C@@H]2C |
| InChI | InChI=1S/C19H18N4O4/c1-11-17(2)26-15(12-6-5-7-13(24-3)14(12)25-4)18(8-20,9-21)19(11,10-22)16(23)27-17/h5-7,11,15,23H,1-4H3/b23-16-/t11-,15-,17+,19-/m1/s1 |
| InChIKey | JSIXCCUXPRCOEI-YFLXUHOLSA-N |
| XLogP | 2.68 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|