C24H20N4O4 — CID 3363749
6-imino-3-(2-methoxyphenyl)-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3363749) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is 6-imino-3-(2-methoxyphenyl)-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 6-imino-3-(2-methoxyphenyl)-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3363749 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 6-imino-3-(2-methoxyphenyl)-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(OC)cc3)OC(c3ccccc3OC)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C24H20N4O4/c1-15-23(14-27)21(28)32-24(15,16-8-10-17(29-2)11-9-16)31-20(22(23,12-25)13-26)18-6-4-5-7-19(18)30-3/h4-11,15,20,28H,1-3H3/b28-21- |
| InChIKey | YRPPYZIIQGXBDB-HFTWOUSFSA-N |
| XLogP | 3.82 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|