C23H13F5N4O3 — CID 3471551
6-imino-1-(4-methoxyphenyl)-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3471551) has the molecular formula C23H13F5N4O3 and a molecular weight of 488.37 g/mol. Its IUPAC name is 6-imino-1-(4-methoxyphenyl)-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 6-imino-1-(4-methoxyphenyl)-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3471551 |
| Molecular Formula | C23H13F5N4O3 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 6-imino-1-(4-methoxyphenyl)-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(OC)cc3)OC(c3c(F)c(F)c(F)c(F)c3F)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C23H13F5N4O3/c1-10-22(9-31)20(32)35-23(10,11-3-5-12(33-2)6-4-11)34-19(21(22,7-29)8-30)13-14(24)16(26)18(28)17(27)15(13)25/h3-6,10,19,32H,1-2H3/b32-20- |
| InChIKey | QIOHNUZGXFVJPF-RGXNXFOYSA-N |
| XLogP | 4.50 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|