C22H10ClF5N4O2 — CID 3501703
1-(4-chlorophenyl)-6-imino-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3501703) has the molecular formula C22H10ClF5N4O2 and a molecular weight of 492.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-imino-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(4-chlorophenyl)-6-imino-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3501703 |
| Molecular Formula | C22H10ClF5N4O2 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 1-(4-chlorophenyl)-6-imino-8-methyl-3-(2,3,4,5,6-pentafluorophenyl)-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Cl)cc3)OC(c3c(F)c(F)c(F)c(F)c3F)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C22H10ClF5N4O2/c1-9-21(8-31)19(32)34-22(9,10-2-4-11(23)5-3-10)33-18(20(21,6-29)7-30)12-13(24)15(26)17(28)16(27)14(12)25/h2-5,9,18,32H,1H3/b32-19- |
| InChIKey | TXESFHWSKFPHHX-MZFJOGFUSA-N |
| XLogP | 5.15 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|