C23H16F2N4O3 — CID 3466535
3-(3,4-difluorophenyl)-6-imino-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3466535) has the molecular formula C23H16F2N4O3 and a molecular weight of 434.40 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-6-imino-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-(3,4-difluorophenyl)-6-imino-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3466535 |
| Molecular Formula | C23H16F2N4O3 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 3-(3,4-difluorophenyl)-6-imino-1-(4-methoxyphenyl)-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(OC)cc3)OC(c3ccc(F)c(F)c3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C23H16F2N4O3/c1-13-22(12-28)20(29)32-23(13,15-4-6-16(30-2)7-5-15)31-19(21(22,10-26)11-27)14-3-8-17(24)18(25)9-14/h3-9,13,19,29H,1-2H3/b29-20- |
| InChIKey | XUSMLSTUARYDCP-BRPDVVIDSA-N |
| XLogP | 4.08 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|