C24H18Cl2N4O4 — CID 4628562
1-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4628562) has the molecular formula C24H18Cl2N4O4 and a molecular weight of 497.34 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4628562 |
| Molecular Formula | C24H18Cl2N4O4 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Cl)cc3Cl)OC(c3ccc(OC)c(OC)c3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C24H18Cl2N4O4/c1-13-23(12-29)21(30)34-24(13,16-6-5-15(25)9-17(16)26)33-20(22(23,10-27)11-28)14-4-7-18(31-2)19(8-14)32-3/h4-9,13,20,30H,1-3H3/b30-21- |
| InChIKey | UGQMHXPLQLYAAG-OFWBYEQRSA-N |
| XLogP | 5.12 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|