C23H14ClF3N4O3 — CID 3523600
1-(3-chlorophenyl)-6-imino-8-methyl-3-[4-(trifluoromethoxy)phenyl]-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3523600) has the molecular formula C23H14ClF3N4O3 and a molecular weight of 486.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-imino-8-methyl-3-[4-(trifluoromethoxy)phenyl]-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(3-chlorophenyl)-6-imino-8-methyl-3-[4-(trifluoromethoxy)phenyl]-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3523600 |
| Molecular Formula | C23H14ClF3N4O3 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 1-(3-chlorophenyl)-6-imino-8-methyl-3-[4-(trifluoromethoxy)phenyl]-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3cccc(Cl)c3)OC(c3ccc(OC(F)(F)F)cc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C23H14ClF3N4O3/c1-13-21(12-30)19(31)34-22(13,15-3-2-4-16(24)9-15)33-18(20(21,10-28)11-29)14-5-7-17(8-6-14)32-23(25,26)27/h2-9,13,18,31H,1H3/b31-19- |
| InChIKey | QTDLSZGXVWXDQK-DXJNIWACSA-N |
| XLogP | 5.35 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|