C29H29ClN4O3 — CID 3513467
1-(3-chlorophenyl)-3-(4-heptoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3513467) has the molecular formula C29H29ClN4O3 and a molecular weight of 517.03 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4-heptoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(3-chlorophenyl)-3-(4-heptoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3513467 |
| Molecular Formula | C29H29ClN4O3 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4-heptoxyphenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3cccc(Cl)c3)OC(c3ccc(OCCCCCCC)cc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C29H29ClN4O3/c1-3-4-5-6-7-15-35-24-13-11-21(12-14-24)25-27(17-31,18-32)28(19-33)20(2)29(36-25,37-26(28)34)22-9-8-10-23(30)16-22/h8-14,16,20,25,34H,3-7,15H2,1-2H3/b34-26- |
| InChIKey | ROYOTVLLIIMZBF-CLIDGEQKSA-N |
| XLogP | 6.80 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|