C29H36N4O3 — CID 3423927
4-tert-butyl-9-(4-hexoxyphenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 3423927) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 4-tert-butyl-9-(4-hexoxyphenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | 4-tert-butyl-9-(4-hexoxyphenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 3423927 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 4-tert-butyl-9-(4-hexoxyphenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCC(C(C)(C)C)CC2C1(C#N)C(C#N)(C#N)C(c1ccc(OCCCCCC)cc1)O3 |
| InChI | InChI=1S/C29H36N4O3/c1-5-6-7-8-15-34-22-11-9-20(10-12-22)24-27(17-30,18-31)28(19-32)23-16-21(26(2,3)4)13-14-29(23,35-24)36-25(28)33/h9-12,21,23-24,33H,5-8,13-16H2,1-4H3/b33-25+ |
| InChIKey | AVYYRXFOHUGEQZ-INKHBPHZSA-N |
| XLogP | 6.43 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|