C21H20N4O3 — CID 100818818
(1R,7R,8R,10S)-13-imino-10-(4-methoxyphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile (PubChem CID 100818818) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (1R,7R,8R,10S)-13-imino-10-(4-methoxyphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile.
| Compound Name | (1R,7R,8R,10S)-13-imino-10-(4-methoxyphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
|---|---|
| PubChem CID | 100818818 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (1R,7R,8R,10S)-13-imino-10-(4-methoxyphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
| SMILES | [H]/N=C1/O[C@]23CCCCC[C@@H]2[C@]1(C#N)C(C#N)(C#N)[C@H](c1ccc(OC)cc1)O3 |
| InChI | InChI=1S/C21H20N4O3/c1-26-15-8-6-14(7-9-15)17-19(11-22,12-23)20(13-24)16-5-3-2-4-10-21(16,27-17)28-18(20)25/h6-9,16-17,25H,2-5,10H2,1H3/b25-18+/t16-,17+,20+,21-/m1/s1 |
| InChIKey | JERHUPHLSFJQFB-XOBSNQSSSA-N |
| XLogP | 3.59 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|