C19H15BrN4O2 — CID 98365587
(1R,6R,7R,9R)-9-(4-bromophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 98365587) has the molecular formula C19H15BrN4O2 and a molecular weight of 411.26 g/mol. Its IUPAC name is (1R,6R,7R,9R)-9-(4-bromophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | (1R,6R,7R,9R)-9-(4-bromophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 98365587 |
| Molecular Formula | C19H15BrN4O2 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (1R,6R,7R,9R)-9-(4-bromophenyl)-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/O[C@]23CCCC[C@@H]2[C@]1(C#N)C(C#N)(C#N)[C@@H](c1ccc(Br)cc1)O3 |
| InChI | InChI=1S/C19H15BrN4O2/c20-13-6-4-12(5-7-13)15-17(9-21,10-22)18(11-23)14-3-1-2-8-19(14,25-15)26-16(18)24/h4-7,14-15,24H,1-3,8H2/b24-16+/t14-,15-,18+,19-/m1/s1 |
| InChIKey | VEYNZJYRKHQYSN-MKAPNHHMSA-N |
| XLogP | 3.96 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|