C20H17BrN4O2 — CID 124773286
(1R,7S,8R,10R)-10-(4-bromophenyl)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile (PubChem CID 124773286) has the molecular formula C20H17BrN4O2 and a molecular weight of 425.29 g/mol. Its IUPAC name is (1R,7S,8R,10R)-10-(4-bromophenyl)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile.
| Compound Name | (1R,7S,8R,10R)-10-(4-bromophenyl)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
|---|---|
| PubChem CID | 124773286 |
| Molecular Formula | C20H17BrN4O2 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (1R,7S,8R,10R)-10-(4-bromophenyl)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
| SMILES | [H]/N=C1/O[C@]23CCCCC[C@H]2[C@]1(C#N)C(C#N)(C#N)[C@@H](c1ccc(Br)cc1)O3 |
| InChI | InChI=1S/C20H17BrN4O2/c21-14-7-5-13(6-8-14)16-18(10-22,11-23)19(12-24)15-4-2-1-3-9-20(15,26-16)27-17(19)25/h5-8,15-16,25H,1-4,9H2/b25-17+/t15-,16+,19-,20+/m0/s1 |
| InChIKey | BHVNHOIIUNPGEL-JLODXGPYSA-N |
| XLogP | 4.35 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|