C20H19N5O2 — CID 3404885
14-imino-11-pyridin-4-yl-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile (PubChem CID 3404885) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 14-imino-11-pyridin-4-yl-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile.
| Compound Name | 14-imino-11-pyridin-4-yl-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile |
|---|---|
| PubChem CID | 3404885 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 14-imino-11-pyridin-4-yl-12,13-dioxatricyclo[7.3.2.01,8]tetradecane-9,10,10-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCCCCCC2C1(C#N)C(C#N)(C#N)C(c1ccncc1)O3 |
| InChI | InChI=1S/C20H19N5O2/c21-11-18(12-22)16(14-6-9-25-10-7-14)26-20-8-4-2-1-3-5-15(20)19(18,13-23)17(24)27-20/h6-7,9-10,15-16,24H,1-5,8H2/b24-17+ |
| InChIKey | KZZKKBDAEKUTAH-JJIBRWJFSA-N |
| XLogP | 3.37 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|