C19H16N4O2 — CID 124535996
(1R,6S,7R,9S)-12-imino-9-phenyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 124535996) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is (1R,6S,7R,9S)-12-imino-9-phenyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | (1R,6S,7R,9S)-12-imino-9-phenyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 124535996 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (1R,6S,7R,9S)-12-imino-9-phenyl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/O[C@]23CCCC[C@H]2[C@]1(C#N)C(C#N)(C#N)[C@H](c1ccccc1)O3 |
| InChI | InChI=1S/C19H16N4O2/c20-10-17(11-21)15(13-6-2-1-3-7-13)24-19-9-5-4-8-14(19)18(17,12-22)16(23)25-19/h1-3,6-7,14-15,23H,4-5,8-9H2/b23-16+/t14-,15-,18-,19+/m0/s1 |
| InChIKey | WZLSMMJVGMRTON-UOPWYQQASA-N |
| XLogP | 3.20 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|